C21H22N4O2 — CID 120630504
(5-amino-2-methylphenyl)-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone (PubChem CID 120630504) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (5-amino-2-methylphenyl)-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 120630504 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (5-amino-2-methylphenyl)-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCCCC1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C21H22N4O2/c1-14-10-11-16(22)13-17(14)21(26)25-12-6-5-9-18(25)20-23-19(24-27-20)15-7-3-2-4-8-15/h2-4,7-8,10-11,13,18H,5-6,9,12,22H2,1H3 |
| InChIKey | CJXLYLMHXJNRMI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|