C18H34O2Si — CID 12063082
[(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-tri(propan-2-yl)silane (PubChem CID 12063082) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is [(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-tri(propan-2-yl)silane.
| Compound Name | [(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 12063082 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [(3aS,4S,7aS)-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)[C@H]1C=CC[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H34O2Si/c1-12(2)21(13(3)4,14(5)6)16-11-9-10-15-17(16)20-18(7,8)19-15/h9,11-17H,10H2,1-8H3/t15-,16-,17-/m0/s1 |
| InChIKey | UDZZAYDDOBDSLI-ULQDDVLXSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|