About 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride
5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride (PubChem CID 120631203) has the molecular formula C19H22ClN3O2
and a molecular weight of 359.86 g/mol. Its IUPAC name is 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride.
Molecular Properties
| Compound Name | 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride |
| PubChem CID | 120631203 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N(C)C1CCN(c2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C19H21N3O2.ClH/c1-13-8-9-14(20)12-16(13)18(23)21(2)17-10-11-22(19(17)24)15-6-4-3-5-7-15;/h3-9,12,17H,10-11,20H2,1-2H3;1H |
| InChIKey | NTHYCQOGRKRXBQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride?
The IUPAC name of 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride (CID 120631203) is 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride.
What is the SMILES notation for 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride?
The canonical SMILES for 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride is Cc1ccc(N)cc1C(=O)N(C)C1CCN(c2ccccc2)C1=O.Cl.
What is the InChIKey of 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride?
The InChIKey is NTHYCQOGRKRXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2.ClH/c1-13-8-9-14(20)12-16(13)18(23)21(2)17-10-11-22(19(17)24)15-6-4-3-5-7-15;/h3-9,12,17H,10-11,20H2,1-2H3;1H.
What are the key properties of 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride?
5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride has a molecular weight of 359.86 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N,2-dimethyl-N-(2-oxo-1-phenylpyrrolidin-3-yl)benzamide;hydrochloride is sourced from PubChem (CID 120631203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).