C15H29N3O — CID 120632718
(2S,4S)-N-[2-(azepan-1-yl)ethyl]-2-methylpiperidine-4-carboxamide (PubChem CID 120632718) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is (2S,4S)-N-[2-(azepan-1-yl)ethyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[2-(azepan-1-yl)ethyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120632718 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | (2S,4S)-N-[2-(azepan-1-yl)ethyl]-2-methylpiperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)NCCN2CCCCCC2)CCN1 |
| InChI | InChI=1S/C15H29N3O/c1-13-12-14(6-7-16-13)15(19)17-8-11-18-9-4-2-3-5-10-18/h13-14,16H,2-12H2,1H3,(H,17,19)/t13-,14-/m0/s1 |
| InChIKey | ACSJBVOFUSFAQS-KBPBESRZSA-N |
| XLogP | 1.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |