C13H20ClN3OS — CID 120633481
3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[2-(2-aminoethyl)-1,3-thiazol-4-yl]methanone;hydrochloride (PubChem CID 120633481) has the molecular formula C13H20ClN3OS and a molecular weight of 301.84 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[2-(2-aminoethyl)-1,3-thiazol-4-yl]methanone;hydrochloride.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[2-(2-aminoethyl)-1,3-thiazol-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120633481 |
| Molecular Formula | C13H20ClN3OS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl-[2-(2-aminoethyl)-1,3-thiazol-4-yl]methanone;hydrochloride |
| SMILES | Cl.NCCc1nc(C(=O)N2CC3CCCC3C2)cs1 |
| InChI | InChI=1S/C13H19N3OS.ClH/c14-5-4-12-15-11(8-18-12)13(17)16-6-9-2-1-3-10(9)7-16;/h8-10H,1-7,14H2;1H |
| InChIKey | HYLUETVCNJUVTC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |