C14H21ClN2OS — CID 120634085
(5-amino-2-methylphenyl)-(2,3-dimethylthiomorpholin-4-yl)methanone;hydrochloride (PubChem CID 120634085) has the molecular formula C14H21ClN2OS and a molecular weight of 300.86 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-(2,3-dimethylthiomorpholin-4-yl)methanone;hydrochloride.
| Compound Name | (5-amino-2-methylphenyl)-(2,3-dimethylthiomorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120634085 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (5-amino-2-methylphenyl)-(2,3-dimethylthiomorpholin-4-yl)methanone;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCSC(C)C1C.Cl |
| InChI | InChI=1S/C14H20N2OS.ClH/c1-9-4-5-12(15)8-13(9)14(17)16-6-7-18-11(3)10(16)2;/h4-5,8,10-11H,6-7,15H2,1-3H3;1H |
| InChIKey | LKGCOGXPGQDBQV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|