About 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol
6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol (PubChem CID 12063514) has the molecular formula C14H25O4P
and a molecular weight of 288.32 g/mol. Its IUPAC name is 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 12063514 |
| Molecular Formula | C14H25O4P |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol |
| SMILES | CC(C)OP(=O)(OC(C)C)C1=CC(C)(C)CC=C1O |
| InChI | InChI=1S/C14H25O4P/c1-10(2)17-19(16,18-11(3)4)13-9-14(5,6)8-7-12(13)15/h7,9-11,15H,8H2,1-6H3 |
| InChIKey | SNVVFLKELWTCPL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol (CID 12063514) is 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol is CC(C)OP(=O)(OC(C)C)C1=CC(C)(C)CC=C1O.
What is the InChIKey of 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol?
The InChIKey is SNVVFLKELWTCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25O4P/c1-10(2)17-19(16,18-11(3)4)13-9-14(5,6)8-7-12(13)15/h7,9-11,15H,8H2,1-6H3.
What are the key properties of 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol?
6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol has a molecular weight of 288.32 g/mol, XLogP of 4.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-di(propan-2-yloxy)phosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 12063514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).