C13H23O4P — CID 12063541
6-diethoxyphosphoryl-3,3,5-trimethylcyclohexa-1,5-dien-1-ol (PubChem CID 12063541) has the molecular formula C13H23O4P and a molecular weight of 274.30 g/mol. Its IUPAC name is 6-diethoxyphosphoryl-3,3,5-trimethylcyclohexa-1,5-dien-1-ol.
| Compound Name | 6-diethoxyphosphoryl-3,3,5-trimethylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 12063541 |
| Molecular Formula | C13H23O4P |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-diethoxyphosphoryl-3,3,5-trimethylcyclohexa-1,5-dien-1-ol |
| SMILES | CCOP(=O)(OCC)C1=C(C)CC(C)(C)C=C1O |
| InChI | InChI=1S/C13H23O4P/c1-6-16-18(15,17-7-2)12-10(3)8-13(4,5)9-11(12)14/h9,14H,6-8H2,1-5H3 |
| InChIKey | QIYHNBMMVVRHFB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|