About N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide
N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 12063626) has the molecular formula C12H10Cl3NO3S2
and a molecular weight of 386.71 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide |
| PubChem CID | 12063626 |
| Molecular Formula | C12H10Cl3NO3S2 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 384.92 |
| IUPAC Name | N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC(c1ccc(O)cc1)C(Cl)(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C12H10Cl3NO3S2/c13-12(14,15)11(8-3-5-9(17)6-4-8)16-21(18,19)10-2-1-7-20-10/h1-7,11,16-17H |
| InChIKey | BAFAUGTZKMBTLK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide?
The IUPAC name of N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide (CID 12063626) is N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide.
What is the SMILES notation for N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide?
The canonical SMILES for N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide is O=S(=O)(NC(c1ccc(O)cc1)C(Cl)(Cl)Cl)c1cccs1.
What is the InChIKey of N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide?
The InChIKey is BAFAUGTZKMBTLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl3NO3S2/c13-12(14,15)11(8-3-5-9(17)6-4-8)16-21(18,19)10-2-1-7-20-10/h1-7,11,16-17H.
What are the key properties of N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide?
N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide has a molecular weight of 386.71 g/mol, XLogP of 3.84, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]thiophene-2-sulfonamide is sourced from PubChem (CID 12063626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).