C18H26N2O2 — CID 120636361
5-amino-N-cyclopentyl-2-methyl-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 120636361) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-amino-N-cyclopentyl-2-methyl-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-amino-N-cyclopentyl-2-methyl-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 120636361 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 5-amino-N-cyclopentyl-2-methyl-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(N)cc1C(=O)N(CC1CCCO1)C1CCCC1 |
| InChI | InChI=1S/C18H26N2O2/c1-13-8-9-14(19)11-17(13)18(21)20(15-5-2-3-6-15)12-16-7-4-10-22-16/h8-9,11,15-16H,2-7,10,12,19H2,1H3 |
| InChIKey | WIJOEEPVRMLNKW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|