C17H26N2O — CID 120636707
(2S,4S)-N,2-dimethyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide (PubChem CID 120636707) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (2S,4S)-N,2-dimethyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide.
| Compound Name | (2S,4S)-N,2-dimethyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120636707 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2S,4S)-N,2-dimethyl-N-(4-propan-2-ylphenyl)piperidine-4-carboxamide |
| SMILES | CC(C)c1ccc(N(C)C(=O)[C@H]2CCN[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C17H26N2O/c1-12(2)14-5-7-16(8-6-14)19(4)17(20)15-9-10-18-13(3)11-15/h5-8,12-13,15,18H,9-11H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | GMZNADVAWDMESR-ZFWWWQNUSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |