C15H29ClN2O3 — CID 120637646
N-[2-(cyclopropylmethoxy)ethyl]-4-(methoxymethyl)-N-methylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120637646) has the molecular formula C15H29ClN2O3 and a molecular weight of 320.86 g/mol. Its IUPAC name is N-[2-(cyclopropylmethoxy)ethyl]-4-(methoxymethyl)-N-methylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(cyclopropylmethoxy)ethyl]-4-(methoxymethyl)-N-methylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120637646 |
| Molecular Formula | C15H29ClN2O3 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[2-(cyclopropylmethoxy)ethyl]-4-(methoxymethyl)-N-methylpiperidine-4-carboxamide;hydrochloride |
| SMILES | COCC1(C(=O)N(C)CCOCC2CC2)CCNCC1.Cl |
| InChI | InChI=1S/C15H28N2O3.ClH/c1-17(9-10-20-11-13-3-4-13)14(18)15(12-19-2)5-7-16-8-6-15;/h13,16H,3-12H2,1-2H3;1H |
| InChIKey | FJVGVGRJPJHBIP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|