C18H20N3O2+ — CID 12063766
3,5,5,11-tetramethyl-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione (PubChem CID 12063766) has the molecular formula C18H20N3O2+ and a molecular weight of 310.38 g/mol. Its IUPAC name is 3,5,5,11-tetramethyl-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione.
| Compound Name | 3,5,5,11-tetramethyl-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione |
|---|---|
| PubChem CID | 12063766 |
| Molecular Formula | C18H20N3O2+ |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3,5,5,11-tetramethyl-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaene-10,12-dione |
| SMILES | CN1C(=O)c2cccc3c4c(cc(c23)C1=O)C[N+](C)(C)CN4C |
| InChI | InChI=1S/C18H20N3O2/c1-19-10-21(3,4)9-11-8-14-15-12(16(11)19)6-5-7-13(15)17(22)20(2)18(14)23/h5-8H,9-10H2,1-4H3/q+1 |
| InChIKey | ONYRPNJXZYYBRU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|