About methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate
methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate (PubChem CID 120638068) has the molecular formula C13H21FN2O3
and a molecular weight of 272.32 g/mol. Its IUPAC name is methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate |
| PubChem CID | 120638068 |
| Molecular Formula | C13H21FN2O3 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(F)CCN(C(=O)[C@H]2CCN[C@@H](C)C2)C1 |
| InChI | InChI=1S/C13H21FN2O3/c1-9-7-10(3-5-15-9)11(17)16-6-4-13(14,8-16)12(18)19-2/h9-10,15H,3-8H2,1-2H3/t9-,10-,13?/m0/s1 |
| InChIKey | HTFLUQYRLIQDFY-UCBNGSGESA-N |
| XLogP | 0.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate?
The IUPAC name of methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate (CID 120638068) is methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate is COC(=O)C1(F)CCN(C(=O)[C@H]2CCN[C@@H](C)C2)C1.
What is the InChIKey of methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate?
The InChIKey is HTFLUQYRLIQDFY-UCBNGSGESA-N. The full InChI is InChI=1S/C13H21FN2O3/c1-9-7-10(3-5-15-9)11(17)16-6-4-13(14,8-16)12(18)19-2/h9-10,15H,3-8H2,1-2H3/t9-,10-,13?/m0/s1.
What are the key properties of methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate?
methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate has a molecular weight of 272.32 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-fluoro-1-[(2S,4S)-2-methylpiperidine-4-carbonyl]pyrrolidine-3-carboxylate is sourced from PubChem (CID 120638068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).