C18H29ClN2O4 — CID 120638200
4-(methoxymethyl)-N-[3-(3-methoxypropoxy)phenyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 120638200) has the molecular formula C18H29ClN2O4 and a molecular weight of 372.89 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-[3-(3-methoxypropoxy)phenyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-(methoxymethyl)-N-[3-(3-methoxypropoxy)phenyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120638200 |
| Molecular Formula | C18H29ClN2O4 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-(methoxymethyl)-N-[3-(3-methoxypropoxy)phenyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | COCCCOc1cccc(NC(=O)C2(COC)CCNCC2)c1.Cl |
| InChI | InChI=1S/C18H28N2O4.ClH/c1-22-11-4-12-24-16-6-3-5-15(13-16)20-17(21)18(14-23-2)7-9-19-10-8-18;/h3,5-6,13,19H,4,7-12,14H2,1-2H3,(H,20,21);1H |
| InChIKey | DQSNRVPMOYVSCY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|