C18H35ClN2O3 — CID 120638673
4-(methoxymethyl)-N-[(1-propoxycyclohexyl)methyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 120638673) has the molecular formula C18H35ClN2O3 and a molecular weight of 362.94 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-[(1-propoxycyclohexyl)methyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-(methoxymethyl)-N-[(1-propoxycyclohexyl)methyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120638673 |
| Molecular Formula | C18H35ClN2O3 |
| Molecular Weight | 362.94 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 4-(methoxymethyl)-N-[(1-propoxycyclohexyl)methyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCOC1(CNC(=O)C2(COC)CCNCC2)CCCCC1.Cl |
| InChI | InChI=1S/C18H34N2O3.ClH/c1-3-13-23-18(7-5-4-6-8-18)14-20-16(21)17(15-22-2)9-11-19-12-10-17;/h19H,3-15H2,1-2H3,(H,20,21);1H |
| InChIKey | ZOLVMFKGSZCQAT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.94 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |