C19H22N2O5S — CID 120639109
methyl 2-[[4-[[(5-amino-2-methylbenzoyl)amino]methyl]phenyl]methylsulfonyl]acetate (PubChem CID 120639109) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is methyl 2-[[4-[[(5-amino-2-methylbenzoyl)amino]methyl]phenyl]methylsulfonyl]acetate.
| Compound Name | methyl 2-[[4-[[(5-amino-2-methylbenzoyl)amino]methyl]phenyl]methylsulfonyl]acetate |
|---|---|
| PubChem CID | 120639109 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | methyl 2-[[4-[[(5-amino-2-methylbenzoyl)amino]methyl]phenyl]methylsulfonyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)Cc1ccc(CNC(=O)c2cc(N)ccc2C)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-13-3-8-16(20)9-17(13)19(23)21-10-14-4-6-15(7-5-14)11-27(24,25)12-18(22)26-2/h3-9H,10-12,20H2,1-2H3,(H,21,23) |
| InChIKey | VRLWXIUEHRDLJP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|