C18H24Cl2N4O — CID 120639469
2-(5-amino-2-pyridinyl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride (PubChem CID 120639469) has the molecular formula C18H24Cl2N4O and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-(5-amino-2-pyridinyl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride.
| Compound Name | 2-(5-amino-2-pyridinyl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120639469 |
| Molecular Formula | C18H24Cl2N4O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(5-amino-2-pyridinyl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)Nc2ccccc2N2CCCCC2)nc1 |
| InChI | InChI=1S/C18H22N4O.2ClH/c19-14-8-9-15(20-13-14)12-18(23)21-16-6-2-3-7-17(16)22-10-4-1-5-11-22;;/h2-3,6-9,13H,1,4-5,10-12,19H2,(H,21,23);2*1H |
| InChIKey | PGNWSVNRHQFOER-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |