C18H32N4O3 — CID 120640227
2-[4-[4-(methoxymethyl)piperidine-4-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 120640227) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[4-[4-(methoxymethyl)piperidine-4-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[4-(methoxymethyl)piperidine-4-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 120640227 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2-[4-[4-(methoxymethyl)piperidine-4-carbonyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | COCC1(C(=O)N2CCN(CC(=O)N3CCCC3)CC2)CCNCC1 |
| InChI | InChI=1S/C18H32N4O3/c1-25-15-18(4-6-19-7-5-18)17(24)22-12-10-20(11-13-22)14-16(23)21-8-2-3-9-21/h19H,2-15H2,1H3 |
| InChIKey | MZGQUFJBCSGYJO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |