C16H22Cl2N2O3 — CID 120641196
(2S,4S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-2-methylpiperidine-4-carboxamide (PubChem CID 120641196) has the molecular formula C16H22Cl2N2O3 and a molecular weight of 361.27 g/mol. Its IUPAC name is (2S,4S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120641196 |
| Molecular Formula | C16H22Cl2N2O3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2S,4S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-2-methylpiperidine-4-carboxamide |
| SMILES | COCCOc1c(Cl)cc(NC(=O)[C@H]2CCN[C@@H](C)C2)cc1Cl |
| InChI | InChI=1S/C16H22Cl2N2O3/c1-10-7-11(3-4-19-10)16(21)20-12-8-13(17)15(14(18)9-12)23-6-5-22-2/h8-11,19H,3-7H2,1-2H3,(H,20,21)/t10-,11-/m0/s1 |
| InChIKey | LPSBJSGAJXDARA-QWRGUYRKSA-N |
| XLogP | 3.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|