C18H30ClN3OS — CID 120641524
(2S,4S)-N-(6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-methylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120641524) has the molecular formula C18H30ClN3OS and a molecular weight of 371.98 g/mol. Its IUPAC name is (2S,4S)-N-(6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-methylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-(6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-methylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120641524 |
| Molecular Formula | C18H30ClN3OS |
| Molecular Weight | 371.98 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2S,4S)-N-(6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-methylpiperidine-4-carboxamide;hydrochloride |
| SMILES | C[C@H]1C[C@@H](C(=O)Nc2nc3c(s2)CC(C(C)(C)C)CC3)CCN1.Cl |
| InChI | InChI=1S/C18H29N3OS.ClH/c1-11-9-12(7-8-19-11)16(22)21-17-20-14-6-5-13(18(2,3)4)10-15(14)23-17;/h11-13,19H,5-10H2,1-4H3,(H,20,21,22);1H/t11-,12-,13?;/m0./s1 |
| InChIKey | LWUMUKNJTLZRSD-TVPPKBNJSA-N |
| XLogP | 4.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |