C17H21N7O2S — CID 120642007
2,3-dimethyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 120642007) has the molecular formula C17H21N7O2S and a molecular weight of 387.47 g/mol. Its IUPAC name is 2,3-dimethyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | 2,3-dimethyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 120642007 |
| Molecular Formula | C17H21N7O2S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2,3-dimethyl-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | Cc1sc2ncc(C(=O)Nc3nc(C4CCNCC4)nn3C)c(=O)n2c1C |
| InChI | InChI=1S/C17H21N7O2S/c1-9-10(2)27-17-19-8-12(15(26)24(9)17)14(25)21-16-20-13(22-23(16)3)11-4-6-18-7-5-11/h8,11,18H,4-7H2,1-3H3,(H,20,21,22,25) |
| InChIKey | MGEUBDRANBKIBQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |