C22H30Cl2N4O3 — CID 120642238
5-amino-2-methyl-N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]benzamide;dihydrochloride (PubChem CID 120642238) has the molecular formula C22H30Cl2N4O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]benzamide;dihydrochloride.
| Compound Name | 5-amino-2-methyl-N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120642238 |
| Molecular Formula | C22H30Cl2N4O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5-amino-2-methyl-N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]benzamide;dihydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NCc1cccc(NC(=O)CCN2CCOCC2)c1.Cl.Cl |
| InChI | InChI=1S/C22H28N4O3.2ClH/c1-16-5-6-18(23)14-20(16)22(28)24-15-17-3-2-4-19(13-17)25-21(27)7-8-26-9-11-29-12-10-26;;/h2-6,13-14H,7-12,15,23H2,1H3,(H,24,28)(H,25,27);2*1H |
| InChIKey | VQAGQUDQAWIWDG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|