C19H27N5O2 — CID 120643222
4-(3-methylphenoxy)-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)butanamide (PubChem CID 120643222) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-(3-methylphenoxy)-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)butanamide.
| Compound Name | 4-(3-methylphenoxy)-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)butanamide |
|---|---|
| PubChem CID | 120643222 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 4-(3-methylphenoxy)-N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)butanamide |
| SMILES | Cc1cccc(OCCCC(=O)Nc2nc(C3CCNCC3)nn2C)c1 |
| InChI | InChI=1S/C19H27N5O2/c1-14-5-3-6-16(13-14)26-12-4-7-17(25)21-19-22-18(23-24(19)2)15-8-10-20-11-9-15/h3,5-6,13,15,20H,4,7-12H2,1-2H3,(H,21,22,23,25) |
| InChIKey | YGXYEIIPEFNDIX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|