About 3-phenylpropyl dimethoxyphosphorylmethanedithioate
3-phenylpropyl dimethoxyphosphorylmethanedithioate (PubChem CID 12064353) has the molecular formula C12H17O3PS2
and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-phenylpropyl dimethoxyphosphorylmethanedithioate.
Molecular Properties
| Compound Name | 3-phenylpropyl dimethoxyphosphorylmethanedithioate |
| PubChem CID | 12064353 |
| Molecular Formula | C12H17O3PS2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-phenylpropyl dimethoxyphosphorylmethanedithioate |
| SMILES | COP(=O)(OC)C(=S)SCCCc1ccccc1 |
| InChI | InChI=1S/C12H17O3PS2/c1-14-16(13,15-2)12(17)18-10-6-9-11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3 |
| InChIKey | SKFAOZIZQGSQOM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropyl dimethoxyphosphorylmethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropyl dimethoxyphosphorylmethanedithioate?
The IUPAC name of 3-phenylpropyl dimethoxyphosphorylmethanedithioate (CID 12064353) is 3-phenylpropyl dimethoxyphosphorylmethanedithioate.
What is the SMILES notation for 3-phenylpropyl dimethoxyphosphorylmethanedithioate?
The canonical SMILES for 3-phenylpropyl dimethoxyphosphorylmethanedithioate is COP(=O)(OC)C(=S)SCCCc1ccccc1.
What is the InChIKey of 3-phenylpropyl dimethoxyphosphorylmethanedithioate?
The InChIKey is SKFAOZIZQGSQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17O3PS2/c1-14-16(13,15-2)12(17)18-10-6-9-11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3.
What are the key properties of 3-phenylpropyl dimethoxyphosphorylmethanedithioate?
3-phenylpropyl dimethoxyphosphorylmethanedithioate has a molecular weight of 304.37 g/mol, XLogP of 4.12, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropyl dimethoxyphosphorylmethanedithioate is sourced from PubChem (CID 12064353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).