C13H24ClN5OS — CID 120645027
N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-2-propylsulfanylacetamide;hydrochloride (PubChem CID 120645027) has the molecular formula C13H24ClN5OS and a molecular weight of 333.89 g/mol. Its IUPAC name is N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-2-propylsulfanylacetamide;hydrochloride.
| Compound Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-2-propylsulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 120645027 |
| Molecular Formula | C13H24ClN5OS |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(2-methyl-5-piperidin-4-yl-1,2,4-triazol-3-yl)-2-propylsulfanylacetamide;hydrochloride |
| SMILES | CCCSCC(=O)Nc1nc(C2CCNCC2)nn1C.Cl |
| InChI | InChI=1S/C13H23N5OS.ClH/c1-3-8-20-9-11(19)15-13-16-12(17-18(13)2)10-4-6-14-7-5-10;/h10,14H,3-9H2,1-2H3,(H,15,16,17,19);1H |
| InChIKey | ZVHSPOJGMMSNBM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|