C21H27N3O — CID 120645194
5-amino-N-[(1-benzylpiperidin-2-yl)methyl]-2-methylbenzamide (PubChem CID 120645194) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 5-amino-N-[(1-benzylpiperidin-2-yl)methyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[(1-benzylpiperidin-2-yl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120645194 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 5-amino-N-[(1-benzylpiperidin-2-yl)methyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NCC1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C21H27N3O/c1-16-10-11-18(22)13-20(16)21(25)23-14-19-9-5-6-12-24(19)15-17-7-3-2-4-8-17/h2-4,7-8,10-11,13,19H,5-6,9,12,14-15,22H2,1H3,(H,23,25) |
| InChIKey | JPULQXDDDLDOIP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|