C16H28N4O2S — CID 120646449
[2-(2-aminoethyl)-1,3-thiazol-4-yl]-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methanone (PubChem CID 120646449) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is [2-(2-aminoethyl)-1,3-thiazol-4-yl]-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methanone.
| Compound Name | [2-(2-aminoethyl)-1,3-thiazol-4-yl]-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120646449 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [2-(2-aminoethyl)-1,3-thiazol-4-yl]-[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methanone |
| SMILES | CCOCCN1CCN(C(=O)c2csc(CCN)n2)CC1CC |
| InChI | InChI=1S/C16H28N4O2S/c1-3-13-11-20(8-7-19(13)9-10-22-4-2)16(21)14-12-23-15(18-14)5-6-17/h12-13H,3-11,17H2,1-2H3 |
| InChIKey | IXTFNGWIXAWUDK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|