C23H30Cl2N4O2 — CID 120646636
2-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;dihydrochloride (PubChem CID 120646636) has the molecular formula C23H30Cl2N4O2 and a molecular weight of 465.43 g/mol. Its IUPAC name is 2-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;dihydrochloride.
| Compound Name | 2-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120646636 |
| Molecular Formula | C23H30Cl2N4O2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-[4-(5-amino-2-methylbenzoyl)piperazin-1-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone;dihydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)N1CCN(CC(=O)N2CCCc3ccccc32)CC1.Cl.Cl |
| InChI | InChI=1S/C23H28N4O2.2ClH/c1-17-8-9-19(24)15-20(17)23(29)26-13-11-25(12-14-26)16-22(28)27-10-4-6-18-5-2-3-7-21(18)27;;/h2-3,5,7-9,15H,4,6,10-14,16,24H2,1H3;2*1H |
| InChIKey | RWADOOVHNWGLRG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|