C17H27Cl2N3O — CID 120647242
5-amino-2-methyl-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzamide;dihydrochloride (PubChem CID 120647242) has the molecular formula C17H27Cl2N3O and a molecular weight of 360.33 g/mol. Its IUPAC name is 5-amino-2-methyl-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzamide;dihydrochloride.
| Compound Name | 5-amino-2-methyl-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120647242 |
| Molecular Formula | C17H27Cl2N3O |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-amino-2-methyl-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzamide;dihydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NC1CC2CCCC(C1)N2C.Cl.Cl |
| InChI | InChI=1S/C17H25N3O.2ClH/c1-11-6-7-12(18)8-16(11)17(21)19-13-9-14-4-3-5-15(10-13)20(14)2;;/h6-8,13-15H,3-5,9-10,18H2,1-2H3,(H,19,21);2*1H |
| InChIKey | DJXNXZAIJZBJOR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|