C17H34N4O2 — CID 120647879
N-[2-(4-ethylpiperazin-1-yl)propyl]-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 120647879) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)propyl]-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120647879 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | CCN1CCN(C(C)CNC(=O)C2(COC)CCNCC2)CC1 |
| InChI | InChI=1S/C17H34N4O2/c1-4-20-9-11-21(12-10-20)15(2)13-19-16(22)17(14-23-3)5-7-18-8-6-17/h15,18H,4-14H2,1-3H3,(H,19,22) |
| InChIKey | APBYRNHPSRNVQH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |