About 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide
1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide (PubChem CID 12064835) has the molecular formula C10H17F6NO3S2
and a molecular weight of 377.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide.
Molecular Properties
| Compound Name | 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide |
| PubChem CID | 12064835 |
| Molecular Formula | C10H17F6NO3S2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide |
| SMILES | CCCCCCCCS(=O)(=NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6NO3S2/c1-2-3-4-5-6-7-8-21(18,9(11,12)13)17-22(19,20)10(14,15)16/h2-8H2,1H3 |
| InChIKey | ZQIVCNBQBXQDNA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide?
The IUPAC name of 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide (CID 12064835) is 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide.
What is the SMILES notation for 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide?
The canonical SMILES for 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide is CCCCCCCCS(=O)(=NS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide?
The InChIKey is ZQIVCNBQBXQDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F6NO3S2/c1-2-3-4-5-6-7-8-21(18,9(11,12)13)17-22(19,20)10(14,15)16/h2-8H2,1H3.
What are the key properties of 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide?
1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide has a molecular weight of 377.37 g/mol, XLogP of 4.18, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoro-N-[octyl-oxo-(trifluoromethyl)-λ6-sulfanylidene]methanesulfonamide is sourced from PubChem (CID 12064835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).