C19H25ClN2OS — CID 120652660
4-benzylsulfanyl-N-[(2R)-2-(ethylamino)propyl]benzamide;hydrochloride (PubChem CID 120652660) has the molecular formula C19H25ClN2OS and a molecular weight of 364.94 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-[(2R)-2-(ethylamino)propyl]benzamide;hydrochloride.
| Compound Name | 4-benzylsulfanyl-N-[(2R)-2-(ethylamino)propyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120652660 |
| Molecular Formula | C19H25ClN2OS |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-benzylsulfanyl-N-[(2R)-2-(ethylamino)propyl]benzamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)c1ccc(SCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H24N2OS.ClH/c1-3-20-15(2)13-21-19(22)17-9-11-18(12-10-17)23-14-16-7-5-4-6-8-16;/h4-12,15,20H,3,13-14H2,1-2H3,(H,21,22);1H/t15-;/m1./s1 |
| InChIKey | QKRIFYOFTDMZCS-XFULWGLBSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |