C21H42O4Si2 — CID 12065435
tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-5-methoxy-2,5-dihydrofuran-2-yl]but-3-enoxy]-dimethylsilane (PubChem CID 12065435) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-5-methoxy-2,5-dihydrofuran-2-yl]but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-5-methoxy-2,5-dihydrofuran-2-yl]but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 12065435 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | tert-butyl-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2R)-5-methoxy-2,5-dihydrofuran-2-yl]but-3-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C=CC(OC)O1 |
| InChI | InChI=1S/C21H42O4Si2/c1-13-16(24-26(9,10)20(2,3)4)19(17-14-15-18(22-8)23-17)25-27(11,12)21(5,6)7/h13-19H,1H2,2-12H3/t16-,17-,18?,19-/m1/s1 |
| InChIKey | ZDSMNWQMSBJFSI-XGNHVKOBSA-N |
| XLogP | 5.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|