C16H22ClN3O2 — CID 120655428
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(5-chloro-2-methoxyanilino)propan-1-one (PubChem CID 120655428) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(5-chloro-2-methoxyanilino)propan-1-one.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(5-chloro-2-methoxyanilino)propan-1-one |
|---|---|
| PubChem CID | 120655428 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(5-chloro-2-methoxyanilino)propan-1-one |
| SMILES | COc1ccc(Cl)cc1NCCC(=O)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-22-15-3-2-13(17)6-14(15)19-5-4-16(21)20-9-11-7-18-8-12(11)10-20/h2-3,6,11-12,18-19H,4-5,7-10H2,1H3/t11-,12+ |
| InChIKey | NLEJXHLKRBWTAD-TXEJJXNPSA-N |
| XLogP | 1.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |