C18H21Cl2N3O2 — CID 120655650
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride (PubChem CID 120655650) has the molecular formula C18H21Cl2N3O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120655650 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenoxy-2-pyridinyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1cc(Oc2ccccc2)ccn1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C18H19N3O2.2ClH/c22-18(21-11-13-9-19-10-14(13)12-21)17-8-16(6-7-20-17)23-15-4-2-1-3-5-15;;/h1-8,13-14,19H,9-12H2;2*1H/t13-,14+;; |
| InChIKey | GJUMNYJNEZJEHH-DUFSSLHGSA-N |
| XLogP | 3.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |