C20H23ClN2O2 — CID 120656242
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenylmethoxyphenyl)methanone;hydrochloride (PubChem CID 120656242) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenylmethoxyphenyl)methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenylmethoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120656242 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-phenylmethoxyphenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(OCc2ccccc2)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C20H22N2O2.ClH/c23-20(22-12-17-10-21-11-18(17)13-22)16-6-8-19(9-7-16)24-14-15-4-2-1-3-5-15;/h1-9,17-18,21H,10-14H2;1H/t17-,18+; |
| InChIKey | YHURLZANDWMKIA-GNXQHMNLSA-N |
| XLogP | 2.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |