C13H15Cl2IN2O — CID 120656296
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-iodophenyl)methanone;hydrochloride (PubChem CID 120656296) has the molecular formula C13H15Cl2IN2O and a molecular weight of 413.09 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-iodophenyl)methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-iodophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120656296 |
| Molecular Formula | C13H15Cl2IN2O |
| Molecular Weight | 413.09 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-iodophenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(I)c(Cl)c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C13H14ClIN2O.ClH/c14-11-3-8(1-2-12(11)15)13(18)17-6-9-4-16-5-10(9)7-17;/h1-3,9-10,16H,4-7H2;1H/t9-,10+; |
| InChIKey | PNGZGWISCBPAGQ-JMVWIVNTSA-N |
| XLogP | 2.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.09 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|