C15H20Cl2N4OS — CID 120657233
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrol-2-yl]methanone;dihydrochloride (PubChem CID 120657233) has the molecular formula C15H20Cl2N4OS and a molecular weight of 375.33 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrol-2-yl]methanone;dihydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrol-2-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120657233 |
| Molecular Formula | C15H20Cl2N4OS |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrol-2-yl]methanone;dihydrochloride |
| SMILES | Cc1nc(-c2c[nH]c(C(=O)N3C[C@H]4CNC[C@H]4C3)c2)cs1.Cl.Cl |
| InChI | InChI=1S/C15H18N4OS.2ClH/c1-9-18-14(8-21-9)10-2-13(17-5-10)15(20)19-6-11-3-16-4-12(11)7-19;;/h2,5,8,11-12,16-17H,3-4,6-7H2,1H3;2*1H/t11-,12+;; |
| InChIKey | TYTYBKDRBPCCJK-FYPKGCJUSA-N |
| XLogP | 2.58 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |