C20H22ClFN2OS — CID 120657357
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)sulfanyl-2-phenylethanone;hydrochloride (PubChem CID 120657357) has the molecular formula C20H22ClFN2OS and a molecular weight of 392.93 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)sulfanyl-2-phenylethanone;hydrochloride.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)sulfanyl-2-phenylethanone;hydrochloride |
|---|---|
| PubChem CID | 120657357 |
| Molecular Formula | C20H22ClFN2OS |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-fluorophenyl)sulfanyl-2-phenylethanone;hydrochloride |
| SMILES | Cl.O=C(C(Sc1ccc(F)cc1)c1ccccc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C20H21FN2OS.ClH/c21-17-6-8-18(9-7-17)25-19(14-4-2-1-3-5-14)20(24)23-12-15-10-22-11-16(15)13-23;/h1-9,15-16,19,22H,10-13H2;1H/t15-,16+,19?; |
| InChIKey | KSLCNXDOWMMZPO-XDTGIFKXSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |