C18H20ClN5O — CID 120657951
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(2-chlorophenyl)-5-cyclopropyl-1,2,4-triazol-3-yl]methanone (PubChem CID 120657951) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(2-chlorophenyl)-5-cyclopropyl-1,2,4-triazol-3-yl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(2-chlorophenyl)-5-cyclopropyl-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 120657951 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(2-chlorophenyl)-5-cyclopropyl-1,2,4-triazol-3-yl]methanone |
| SMILES | O=C(c1nc(C2CC2)n(-c2ccccc2Cl)n1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C18H20ClN5O/c19-14-3-1-2-4-15(14)24-17(11-5-6-11)21-16(22-24)18(25)23-9-12-7-20-8-13(12)10-23/h1-4,11-13,20H,5-10H2/t12-,13+ |
| InChIKey | TYEJWUKYHYXASV-BETUJISGSA-N |
| XLogP | 2.09 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |