C18H26ClN3O2 — CID 120657952
N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-3-(4-methylphenyl)propanamide;hydrochloride (PubChem CID 120657952) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-3-(4-methylphenyl)propanamide;hydrochloride.
| Compound Name | N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-3-(4-methylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120657952 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]-3-(4-methylphenyl)propanamide;hydrochloride |
| SMILES | Cc1ccc(CCC(=O)NCC(=O)N2C[C@H]3CNC[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C18H25N3O2.ClH/c1-13-2-4-14(5-3-13)6-7-17(22)20-10-18(23)21-11-15-8-19-9-16(15)12-21;/h2-5,15-16,19H,6-12H2,1H3,(H,20,22);1H/t15-,16+; |
| InChIKey | YVIYQFYXSIECPL-FAESNJTISA-N |
| XLogP | 1.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |