C17H20Cl2FN3OS — CID 120658164
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone;dihydrochloride (PubChem CID 120658164) has the molecular formula C17H20Cl2FN3OS and a molecular weight of 404.34 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone;dihydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120658164 |
| Molecular Formula | C17H20Cl2FN3OS |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanone;dihydrochloride |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)N1C[C@H]2CNC[C@H]2C1.Cl.Cl |
| InChI | InChI=1S/C17H18FN3OS.2ClH/c1-10-15(17(22)21-8-12-6-19-7-13(12)9-21)23-16(20-10)11-2-4-14(18)5-3-11;;/h2-5,12-13,19H,6-9H2,1H3;2*1H/t12-,13+;; |
| InChIKey | BUHHXFPTDMKVPC-FQDOXHKTSA-N |
| XLogP | 3.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |