C12H16Cl2FN3O — CID 120659128
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-4-pyridinyl)methanone;dihydrochloride (PubChem CID 120659128) has the molecular formula C12H16Cl2FN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-4-pyridinyl)methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-4-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120659128 |
| Molecular Formula | C12H16Cl2FN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-4-pyridinyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccncc1F)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C12H14FN3O.2ClH/c13-11-5-14-2-1-10(11)12(17)16-6-8-3-15-4-9(8)7-16;;/h1-2,5,8-9,15H,3-4,6-7H2;2*1H/t8-,9+;; |
| InChIKey | OUZSROUQNPKOBX-DRJPZDRJSA-N |
| XLogP | 1.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |