C19H28ClN3O3 — CID 120659450
N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-(2-ethoxyphenyl)-3-oxopropyl]acetamide;hydrochloride (PubChem CID 120659450) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-(2-ethoxyphenyl)-3-oxopropyl]acetamide;hydrochloride.
| Compound Name | N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-(2-ethoxyphenyl)-3-oxopropyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120659450 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1-(2-ethoxyphenyl)-3-oxopropyl]acetamide;hydrochloride |
| SMILES | CCOc1ccccc1C(CC(=O)N1C[C@H]2CNC[C@H]2C1)NC(C)=O.Cl |
| InChI | InChI=1S/C19H27N3O3.ClH/c1-3-25-18-7-5-4-6-16(18)17(21-13(2)23)8-19(24)22-11-14-9-20-10-15(14)12-22;/h4-7,14-15,17,20H,3,8-12H2,1-2H3,(H,21,23);1H/t14-,15+,17?; |
| InChIKey | WZZIIIJSFHQZDN-QVLMFNNZSA-N |
| XLogP | 1.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |