C12H21ClN2O2 — CID 120660109
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxycyclopropyl)methanone;hydrochloride (PubChem CID 120660109) has the molecular formula C12H21ClN2O2 and a molecular weight of 260.76 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxycyclopropyl)methanone;hydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxycyclopropyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120660109 |
| Molecular Formula | C12H21ClN2O2 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethoxycyclopropyl)methanone;hydrochloride |
| SMILES | CCOC1CC1C(=O)N1C[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C12H20N2O2.ClH/c1-2-16-11-3-10(11)12(15)14-6-8-4-13-5-9(8)7-14;/h8-11,13H,2-7H2,1H3;1H/t8-,9+,10?,11?; |
| InChIKey | IZBAAWZDRQYWHE-NYLBFTITSA-N |
| XLogP | 0.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |