C13H25ClN2O3S — CID 120660164
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(2-methylpropylsulfonyl)propan-1-one;hydrochloride (PubChem CID 120660164) has the molecular formula C13H25ClN2O3S and a molecular weight of 324.87 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(2-methylpropylsulfonyl)propan-1-one;hydrochloride.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(2-methylpropylsulfonyl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120660164 |
| Molecular Formula | C13H25ClN2O3S |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-(2-methylpropylsulfonyl)propan-1-one;hydrochloride |
| SMILES | CC(C)CS(=O)(=O)CCC(=O)N1C[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C13H24N2O3S.ClH/c1-10(2)9-19(17,18)4-3-13(16)15-7-11-5-14-6-12(11)8-15;/h10-12,14H,3-9H2,1-2H3;1H/t11-,12+; |
| InChIKey | MKQOAIUIQABWDV-IWKKHLOMSA-N |
| XLogP | 0.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |