C17H17ClFN3O2 — CID 120660254
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone (PubChem CID 120660254) has the molecular formula C17H17ClFN3O2 and a molecular weight of 349.79 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 120660254 |
| Molecular Formula | C17H17ClFN3O2 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C17H17ClFN3O2/c1-9-14(17(23)22-7-10-5-20-6-11(10)8-22)16(21-24-9)15-12(18)3-2-4-13(15)19/h2-4,10-11,20H,5-8H2,1H3/t10-,11+ |
| InChIKey | FWJIBNXOBZKKLF-PHIMTYICSA-N |
| XLogP | 2.73 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |