About [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane
[(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 12066078) has the molecular formula C24H34O3S2Si
and a molecular weight of 462.75 g/mol. Its IUPAC name is [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane |
| PubChem CID | 12066078 |
| Molecular Formula | C24H34O3S2Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | Cc1ccc(S(=O)/C=C(\CCO[Si](C)(C)C(C)(C)C)S(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H34O3S2Si/c1-19-8-12-21(13-9-19)28(25)18-23(16-17-27-30(6,7)24(3,4)5)29(26)22-14-10-20(2)11-15-22/h8-15,18H,16-17H2,1-7H3/b23-18+ |
| InChIKey | LYAJWROQNMEZJO-PTGBLXJZSA-N |
| XLogP | 6.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane?
The IUPAC name of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane (CID 12066078) is [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane.
What is the SMILES notation for [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane?
The canonical SMILES for [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane is Cc1ccc(S(=O)/C=C(\CCO[Si](C)(C)C(C)(C)C)S(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane?
The InChIKey is LYAJWROQNMEZJO-PTGBLXJZSA-N. The full InChI is InChI=1S/C24H34O3S2Si/c1-19-8-12-21(13-9-19)28(25)18-23(16-17-27-30(6,7)24(3,4)5)29(26)22-14-10-20(2)11-15-22/h8-15,18H,16-17H2,1-7H3/b23-18+.
What are the key properties of [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane?
[(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane has a molecular weight of 462.75 g/mol, XLogP of 6.47, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-tert-butyl-dimethylsilane is sourced from PubChem (CID 12066078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).