C14H23ClN4OS — CID 120660844
N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide;hydrochloride (PubChem CID 120660844) has the molecular formula C14H23ClN4OS and a molecular weight of 330.89 g/mol. Its IUPAC name is N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide;hydrochloride.
| Compound Name | N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide;hydrochloride |
|---|---|
| PubChem CID | 120660844 |
| Molecular Formula | C14H23ClN4OS |
| Molecular Weight | 330.89 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]methyl]-1,3-thiazol-2-yl]-N-ethylacetamide;hydrochloride |
| SMILES | CCN(C(C)=O)c1nc(CN2C[C@H]3CNC[C@H]3C2)cs1.Cl |
| InChI | InChI=1S/C14H22N4OS.ClH/c1-3-18(10(2)19)14-16-13(9-20-14)8-17-6-11-4-15-5-12(11)7-17;/h9,11-12,15H,3-8H2,1-2H3;1H/t11-,12+; |
| InChIKey | KHXKDZJIOIFKIW-IWKKHLOMSA-N |
| XLogP | 1.59 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.89 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |